C18H20N3OPS — CID 129262978
1-methyl-1-[3-methyl-2-[[4-(4-phosphanylphenyl)-1,3-thiazol-2-yl]oxymethyl]phenyl]hydrazine (PubChem CID 129262978) has the molecular formula C18H20N3OPS and a molecular weight of 357.42 g/mol. Its IUPAC name is 1-methyl-1-[3-methyl-2-[[4-(4-phosphanylphenyl)-1,3-thiazol-2-yl]oxymethyl]phenyl]hydrazine.
| Compound Name | 1-methyl-1-[3-methyl-2-[[4-(4-phosphanylphenyl)-1,3-thiazol-2-yl]oxymethyl]phenyl]hydrazine |
|---|---|
| PubChem CID | 129262978 |
| Molecular Formula | C18H20N3OPS |
| Molecular Weight | 357.42 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | 1-methyl-1-[3-methyl-2-[[4-(4-phosphanylphenyl)-1,3-thiazol-2-yl]oxymethyl]phenyl]hydrazine |
| SMILES | Cc1cccc(N(C)N)c1COc1nc(-c2ccc(P)cc2)cs1 |
| InChI | InChI=1S/C18H20N3OPS/c1-12-4-3-5-17(21(2)19)15(12)10-22-18-20-16(11-24-18)13-6-8-14(23)9-7-13/h3-9,11H,10,19,23H2,1-2H3 |
| InChIKey | BRMRJIDYGDKUEG-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.42 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|