C16H21N3S — CID 129273160
N-(cyclohexylideneamino)-4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1,3-thiazol-2-amine (PubChem CID 129273160) has the molecular formula C16H21N3S and a molecular weight of 287.43 g/mol. Its IUPAC name is N-(cyclohexylideneamino)-4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1,3-thiazol-2-amine.
| Compound Name | N-(cyclohexylideneamino)-4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 129273160 |
| Molecular Formula | C16H21N3S |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | N-(cyclohexylideneamino)-4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1,3-thiazol-2-amine |
| SMILES | C=C/C=C(\C=C/C)c1csc(NN=C2CCCCC2)n1 |
| InChI | InChI=1S/C16H21N3S/c1-3-8-13(9-4-2)15-12-20-16(17-15)19-18-14-10-6-5-7-11-14/h3-4,8-9,12H,1,5-7,10-11H2,2H3,(H,17,19)/b9-4-,13-8+ |
| InChIKey | KQNLSPJIQZZNDE-NTHABNPXSA-N |
| XLogP | 5.02 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|