C23H17N7OS2 — CID 174246123
4-[2-[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1,3-thiazol-2-yl]-3-oxo-4-(1,3-thiazol-2-yldiazenyl)-1H-pyrazol-5-yl]benzonitrile (PubChem CID 174246123) has the molecular formula C23H17N7OS2 and a molecular weight of 471.57 g/mol. Its IUPAC name is 4-[2-[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1,3-thiazol-2-yl]-3-oxo-4-(1,3-thiazol-2-yldiazenyl)-1H-pyrazol-5-yl]benzonitrile.
| Compound Name | 4-[2-[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1,3-thiazol-2-yl]-3-oxo-4-(1,3-thiazol-2-yldiazenyl)-1H-pyrazol-5-yl]benzonitrile |
|---|---|
| PubChem CID | 174246123 |
| Molecular Formula | C23H17N7OS2 |
| Molecular Weight | 471.57 g/mol |
| Exact Mass | 471.09 |
| IUPAC Name | 4-[2-[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1,3-thiazol-2-yl]-3-oxo-4-(1,3-thiazol-2-yldiazenyl)-1H-pyrazol-5-yl]benzonitrile |
| SMILES | C=C/C=C(\C=C/C)c1csc(-n2[nH]c(-c3ccc(C#N)cc3)c(/N=N/c3nccs3)c2=O)n1 |
| InChI | InChI=1S/C23H17N7OS2/c1-3-5-16(6-4-2)18-14-33-23(26-18)30-21(31)20(27-28-22-25-11-12-32-22)19(29-30)17-9-7-15(13-24)8-10-17/h3-12,14,29H,1H2,2H3/b6-4-,16-5+,28-27+ |
| InChIKey | AMJCCNBAHWSGTP-XQFQGZABSA-N |
| XLogP | 6.18 |
| TPSA | 112.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.57 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|