C25H27N3O4 — CID 129279639
[1-[2-(1,3-dioxoisoindol-2-yl)ethyl]piperidin-4-yl]-[(1R,2S)-2-phenylcyclopropyl]carbamic acid (PubChem CID 129279639) has the molecular formula C25H27N3O4 and a molecular weight of 433.51 g/mol. Its IUPAC name is [1-[2-(1,3-dioxoisoindol-2-yl)ethyl]piperidin-4-yl]-[(1R,2S)-2-phenylcyclopropyl]carbamic acid.
| Compound Name | [1-[2-(1,3-dioxoisoindol-2-yl)ethyl]piperidin-4-yl]-[(1R,2S)-2-phenylcyclopropyl]carbamic acid |
|---|---|
| PubChem CID | 129279639 |
| Molecular Formula | C25H27N3O4 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | [1-[2-(1,3-dioxoisoindol-2-yl)ethyl]piperidin-4-yl]-[(1R,2S)-2-phenylcyclopropyl]carbamic acid |
| SMILES | O=C1c2ccccc2C(=O)N1CCN1CCC(N(C(=O)O)[C@@H]2C[C@H]2c2ccccc2)CC1 |
| InChI | InChI=1S/C25H27N3O4/c29-23-19-8-4-5-9-20(19)24(30)27(23)15-14-26-12-10-18(11-13-26)28(25(31)32)22-16-21(22)17-6-2-1-3-7-17/h1-9,18,21-22H,10-16H2,(H,31,32)/t21-,22+/m0/s1 |
| InChIKey | RXSWIHMDAZSRRZ-FCHUYYIVSA-N |
| XLogP | 3.28 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|