C18H23N2O2+ — CID 129290460
(E)-5-[4-(4-acetylpyridin-1-ium-1-yl)butylimino]-3-ethenylpent-3-en-2-one (PubChem CID 129290460) has the molecular formula C18H23N2O2+ and a molecular weight of 299.39 g/mol. Its IUPAC name is (E)-5-[4-(4-acetylpyridin-1-ium-1-yl)butylimino]-3-ethenylpent-3-en-2-one.
| Compound Name | (E)-5-[4-(4-acetylpyridin-1-ium-1-yl)butylimino]-3-ethenylpent-3-en-2-one |
|---|---|
| PubChem CID | 129290460 |
| Molecular Formula | C18H23N2O2+ |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.18 |
| IUPAC Name | (E)-5-[4-(4-acetylpyridin-1-ium-1-yl)butylimino]-3-ethenylpent-3-en-2-one |
| SMILES | C=C/C(=C\C=N\CCCC[n+]1ccc(C(C)=O)cc1)C(C)=O |
| InChI | InChI=1S/C18H23N2O2/c1-4-17(15(2)21)7-11-19-10-5-6-12-20-13-8-18(9-14-20)16(3)22/h4,7-9,11,13-14H,1,5-6,10,12H2,2-3H3/q+1/b17-7+,19-11+ |
| InChIKey | UJDPVTWCWUJWNU-QGQXVBDASA-N |
| XLogP | 2.73 |
| TPSA | 50.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|