C17H21N2O2+ — CID 129290488
(E)-5-[3-(4-acetylpyridin-1-ium-1-yl)propylimino]-3-ethenylpent-3-en-2-one (PubChem CID 129290488) has the molecular formula C17H21N2O2+ and a molecular weight of 285.37 g/mol. Its IUPAC name is (E)-5-[3-(4-acetylpyridin-1-ium-1-yl)propylimino]-3-ethenylpent-3-en-2-one.
| Compound Name | (E)-5-[3-(4-acetylpyridin-1-ium-1-yl)propylimino]-3-ethenylpent-3-en-2-one |
|---|---|
| PubChem CID | 129290488 |
| Molecular Formula | C17H21N2O2+ |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | (E)-5-[3-(4-acetylpyridin-1-ium-1-yl)propylimino]-3-ethenylpent-3-en-2-one |
| SMILES | C=C/C(=C\C=N\CCC[n+]1ccc(C(C)=O)cc1)C(C)=O |
| InChI | InChI=1S/C17H21N2O2/c1-4-16(14(2)20)6-10-18-9-5-11-19-12-7-17(8-13-19)15(3)21/h4,6-8,10,12-13H,1,5,9,11H2,2-3H3/q+1/b16-6+,18-10+ |
| InChIKey | KOGLJGXEISSFNO-OQRRJVBDSA-N |
| XLogP | 2.34 |
| TPSA | 50.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|