C25H51N — CID 129293558
N-(2,2-dimethylpropyl)-8-methylidene-N-nonyldecan-1-amine (PubChem CID 129293558) has the molecular formula C25H51N and a molecular weight of 365.69 g/mol. Its IUPAC name is N-(2,2-dimethylpropyl)-8-methylidene-N-nonyldecan-1-amine.
| Compound Name | N-(2,2-dimethylpropyl)-8-methylidene-N-nonyldecan-1-amine |
|---|---|
| PubChem CID | 129293558 |
| Molecular Formula | C25H51N |
| Molecular Weight | 365.69 g/mol |
| Exact Mass | 365.40 |
| IUPAC Name | N-(2,2-dimethylpropyl)-8-methylidene-N-nonyldecan-1-amine |
| SMILES | C=C(CC)CCCCCCCN(CCCCCCCCC)CC(C)(C)C |
| InChI | InChI=1S/C25H51N/c1-7-9-10-11-12-15-18-21-26(23-25(4,5)6)22-19-16-13-14-17-20-24(3)8-2/h3,7-23H2,1-2,4-6H3 |
| InChIKey | ZMSUUEFAQNQLQI-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.69 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|