C16H14O3 — CID 129304620
4-[1-(4-methoxyphenyl)-1-oxopropan-2-ylidene]cyclohexa-2,5-dien-1-one (PubChem CID 129304620) has the molecular formula C16H14O3 and a molecular weight of 254.28 g/mol. Its IUPAC name is 4-[1-(4-methoxyphenyl)-1-oxopropan-2-ylidene]cyclohexa-2,5-dien-1-one.
| Compound Name | 4-[1-(4-methoxyphenyl)-1-oxopropan-2-ylidene]cyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 129304620 |
| Molecular Formula | C16H14O3 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 4-[1-(4-methoxyphenyl)-1-oxopropan-2-ylidene]cyclohexa-2,5-dien-1-one |
| SMILES | COc1ccc(C(=O)C(C)=C2C=CC(=O)C=C2)cc1 |
| InChI | InChI=1S/C16H14O3/c1-11(12-3-7-14(17)8-4-12)16(18)13-5-9-15(19-2)10-6-13/h3-10H,1-2H3 |
| InChIKey | HCUQQZFZWOKWGQ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|