C10H14NO5PS — CID 12930637
N-(2-methoxy-1,3,2lambda5-dioxaphospholan-2-ylidene)-4-methylbenzenesulfonamide (PubChem CID 12930637) has the molecular formula C10H14NO5PS and a molecular weight of 291.26 g/mol. Its IUPAC name is N-(2-methoxy-1,3,2lambda5-dioxaphospholan-2-ylidene)-4-methylbenzenesulfonamide.
| Compound Name | N-(2-methoxy-1,3,2lambda5-dioxaphospholan-2-ylidene)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 12930637 |
| Molecular Formula | C10H14NO5PS |
| Molecular Weight | 291.26 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | N-(2-methoxy-1,3,2lambda5-dioxaphospholan-2-ylidene)-4-methylbenzenesulfonamide |
| SMILES | COP1(=NS(=O)(=O)c2ccc(C)cc2)OCCO1 |
| InChI | InChI=1S/C10H14NO5PS/c1-9-3-5-10(6-4-9)18(12,13)11-17(14-2)15-7-8-16-17/h3-6H,7-8H2,1-2H3 |
| InChIKey | BIOHLLYCEJQCOO-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.26 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|