C11H20N2O — CID 129313291
N-[(2Z,4E)-1-(dimethylamino)hepta-2,4-dien-4-yl]acetamide (PubChem CID 129313291) has the molecular formula C11H20N2O and a molecular weight of 196.29 g/mol. Its IUPAC name is N-[(2Z,4E)-1-(dimethylamino)hepta-2,4-dien-4-yl]acetamide.
| Compound Name | N-[(2Z,4E)-1-(dimethylamino)hepta-2,4-dien-4-yl]acetamide |
|---|---|
| PubChem CID | 129313291 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | N-[(2Z,4E)-1-(dimethylamino)hepta-2,4-dien-4-yl]acetamide |
| SMILES | CC/C=C(\C=C/CN(C)C)NC(C)=O |
| InChI | InChI=1S/C11H20N2O/c1-5-7-11(12-10(2)14)8-6-9-13(3)4/h6-8H,5,9H2,1-4H3,(H,12,14)/b8-6-,11-7+ |
| InChIKey | GYEZYVBMAUPTEU-FAWHLJIPSA-N |
| XLogP | 1.53 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|