C10H17FN2O — CID 156548246
N-[(3E)-5-aminohexa-3,5-dien-3-yl]-3-fluoro-N-methylpropanamide (PubChem CID 156548246) has the molecular formula C10H17FN2O and a molecular weight of 200.26 g/mol. Its IUPAC name is N-[(3E)-5-aminohexa-3,5-dien-3-yl]-3-fluoro-N-methylpropanamide.
| Compound Name | N-[(3E)-5-aminohexa-3,5-dien-3-yl]-3-fluoro-N-methylpropanamide |
|---|---|
| PubChem CID | 156548246 |
| Molecular Formula | C10H17FN2O |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | N-[(3E)-5-aminohexa-3,5-dien-3-yl]-3-fluoro-N-methylpropanamide |
| SMILES | C=C(N)/C=C(\CC)N(C)C(=O)CCF |
| InChI | InChI=1S/C10H17FN2O/c1-4-9(7-8(2)12)13(3)10(14)5-6-11/h7H,2,4-6,12H2,1,3H3/b9-7+ |
| InChIKey | ISQDRMWAYANNJK-VQHVLOKHSA-N |
| XLogP | 1.57 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|