C11H8N4O3 — CID 12933240
7-hydroxy-8-phenyl-3H-purine-2,6-dione (PubChem CID 12933240) has the molecular formula C11H8N4O3 and a molecular weight of 244.21 g/mol. Its IUPAC name is 7-hydroxy-8-phenyl-3H-purine-2,6-dione.
| Compound Name | 7-hydroxy-8-phenyl-3H-purine-2,6-dione |
|---|---|
| PubChem CID | 12933240 |
| Molecular Formula | C11H8N4O3 |
| Molecular Weight | 244.21 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | 7-hydroxy-8-phenyl-3H-purine-2,6-dione |
| SMILES | O=c1[nH]c(=O)c2c(nc(-c3ccccc3)n2O)[nH]1 |
| InChI | InChI=1S/C11H8N4O3/c16-10-7-8(13-11(17)14-10)12-9(15(7)18)6-4-2-1-3-5-6/h1-5,18H,(H2,13,14,16,17) |
| InChIKey | BDFUPGOBBUGQJR-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 103.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.21 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|