C14H20N4O2S — CID 129345224
[(4aS,8aR)-6-methyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-4-yl]-(4-cyclopropylthiadiazol-5-yl)methanone (PubChem CID 129345224) has the molecular formula C14H20N4O2S and a molecular weight of 308.41 g/mol. Its IUPAC name is [(4aS,8aR)-6-methyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-4-yl]-(4-cyclopropylthiadiazol-5-yl)methanone.
| Compound Name | [(4aS,8aR)-6-methyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-4-yl]-(4-cyclopropylthiadiazol-5-yl)methanone |
|---|---|
| PubChem CID | 129345224 |
| Molecular Formula | C14H20N4O2S |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | [(4aS,8aR)-6-methyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-4-yl]-(4-cyclopropylthiadiazol-5-yl)methanone |
| SMILES | CN1CC[C@H]2OCCN(C(=O)c3snnc3C3CC3)[C@H]2C1 |
| InChI | InChI=1S/C14H20N4O2S/c1-17-5-4-11-10(8-17)18(6-7-20-11)14(19)13-12(9-2-3-9)15-16-21-13/h9-11H,2-8H2,1H3/t10-,11+/m0/s1 |
| InChIKey | KQSGWSXCVFLRQI-WDEREUQCSA-N |
| XLogP | 0.96 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |