C20H27N3O2 — CID 129370018
1,3,5-trimethyl-N-[3-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]oxy]propyl]pyrazole-4-carboxamide (PubChem CID 129370018) has the molecular formula C20H27N3O2 and a molecular weight of 341.46 g/mol. Its IUPAC name is 1,3,5-trimethyl-N-[3-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]oxy]propyl]pyrazole-4-carboxamide.
| Compound Name | 1,3,5-trimethyl-N-[3-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]oxy]propyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 129370018 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | 1,3,5-trimethyl-N-[3-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]oxy]propyl]pyrazole-4-carboxamide |
| SMILES | Cc1nn(C)c(C)c1C(=O)NCCCO[C@@H]1CCCc2ccccc21 |
| InChI | InChI=1S/C20H27N3O2/c1-14-19(15(2)23(3)22-14)20(24)21-12-7-13-25-18-11-6-9-16-8-4-5-10-17(16)18/h4-5,8,10,18H,6-7,9,11-13H2,1-3H3,(H,21,24)/t18-/m1/s1 |
| InChIKey | JEQLBSCATMTCHG-GOSISDBHSA-N |
| XLogP | 3.25 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|