C11H13N — CID 12937829
2-benzylbuta-2,3-dien-1-amine (PubChem CID 12937829) has the molecular formula C11H13N and a molecular weight of 159.23 g/mol. Its IUPAC name is 2-benzylbuta-2,3-dien-1-amine.
| Compound Name | 2-benzylbuta-2,3-dien-1-amine |
|---|---|
| PubChem CID | 12937829 |
| Molecular Formula | C11H13N |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | 2-benzylbuta-2,3-dien-1-amine |
| SMILES | C=C=C(CN)Cc1ccccc1 |
| InChI | InChI=1S/C11H13N/c1-2-10(9-12)8-11-6-4-3-5-7-11/h3-7H,1,8-9,12H2 |
| InChIKey | VKCCNOPDNPIYMS-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |