C11H14ClN — CID 88786997
2-benzylbuta-2,3-dien-1-amine;hydrochloride (PubChem CID 88786997) has the molecular formula C11H14ClN and a molecular weight of 195.69 g/mol. Its IUPAC name is 2-benzylbuta-2,3-dien-1-amine;hydrochloride.
| Compound Name | 2-benzylbuta-2,3-dien-1-amine;hydrochloride |
|---|---|
| PubChem CID | 88786997 |
| Molecular Formula | C11H14ClN |
| Molecular Weight | 195.69 g/mol |
| Exact Mass | 195.08 |
| IUPAC Name | 2-benzylbuta-2,3-dien-1-amine;hydrochloride |
| SMILES | C=C=C(CN)Cc1ccccc1.Cl |
| InChI | InChI=1S/C11H13N.ClH/c1-2-10(9-12)8-11-6-4-3-5-7-11;/h3-7H,1,8-9,12H2;1H |
| InChIKey | WQUYDHXGIFVACI-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.69 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |