C19H20FNO4S — CID 129384889
2-[4-[(3S)-1-(4-fluorophenyl)sulfonylpiperidin-3-yl]phenyl]acetic acid (PubChem CID 129384889) has the molecular formula C19H20FNO4S and a molecular weight of 377.44 g/mol. Its IUPAC name is 2-[4-[(3S)-1-(4-fluorophenyl)sulfonylpiperidin-3-yl]phenyl]acetic acid.
| Compound Name | 2-[4-[(3S)-1-(4-fluorophenyl)sulfonylpiperidin-3-yl]phenyl]acetic acid |
|---|---|
| PubChem CID | 129384889 |
| Molecular Formula | C19H20FNO4S |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | 2-[4-[(3S)-1-(4-fluorophenyl)sulfonylpiperidin-3-yl]phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc([C@@H]2CCCN(S(=O)(=O)c3ccc(F)cc3)C2)cc1 |
| InChI | InChI=1S/C19H20FNO4S/c20-17-7-9-18(10-8-17)26(24,25)21-11-1-2-16(13-21)15-5-3-14(4-6-15)12-19(22)23/h3-10,16H,1-2,11-13H2,(H,22,23)/t16-/m1/s1 |
| InChIKey | MYJYEGZUHCNVNU-MRXNPFEDSA-N |
| XLogP | 3.02 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |