C25H24FNO4S — CID 24863183
2-[3-[1-(4-fluorophenyl)sulfonyl-4-phenylpiperidin-3-yl]phenyl]acetic acid (PubChem CID 24863183) has the molecular formula C25H24FNO4S and a molecular weight of 453.54 g/mol. Its IUPAC name is 2-[3-[1-(4-fluorophenyl)sulfonyl-4-phenylpiperidin-3-yl]phenyl]acetic acid.
| Compound Name | 2-[3-[1-(4-fluorophenyl)sulfonyl-4-phenylpiperidin-3-yl]phenyl]acetic acid |
|---|---|
| PubChem CID | 24863183 |
| Molecular Formula | C25H24FNO4S |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | 2-[3-[1-(4-fluorophenyl)sulfonyl-4-phenylpiperidin-3-yl]phenyl]acetic acid |
| SMILES | O=C(O)Cc1cccc(C2CN(S(=O)(=O)c3ccc(F)cc3)CCC2c2ccccc2)c1 |
| InChI | InChI=1S/C25H24FNO4S/c26-21-9-11-22(12-10-21)32(30,31)27-14-13-23(19-6-2-1-3-7-19)24(17-27)20-8-4-5-18(15-20)16-25(28)29/h1-12,15,23-24H,13-14,16-17H2,(H,28,29) |
| InChIKey | APXXLJRASRHFMQ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |