C22H26FNO4 — CID 143596671
2-[3-[1-(4-fluorophenyl)-4-methylpiperidin-3-yl]phenyl]acetic acid;formaldehyde (PubChem CID 143596671) has the molecular formula C22H26FNO4 and a molecular weight of 387.45 g/mol. Its IUPAC name is 2-[3-[1-(4-fluorophenyl)-4-methylpiperidin-3-yl]phenyl]acetic acid;formaldehyde.
| Compound Name | 2-[3-[1-(4-fluorophenyl)-4-methylpiperidin-3-yl]phenyl]acetic acid;formaldehyde |
|---|---|
| PubChem CID | 143596671 |
| Molecular Formula | C22H26FNO4 |
| Molecular Weight | 387.45 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 2-[3-[1-(4-fluorophenyl)-4-methylpiperidin-3-yl]phenyl]acetic acid;formaldehyde |
| SMILES | C=O.C=O.CC1CCN(c2ccc(F)cc2)CC1c1cccc(CC(=O)O)c1 |
| InChI | InChI=1S/C20H22FNO2.2CH2O/c1-14-9-10-22(18-7-5-17(21)6-8-18)13-19(14)16-4-2-3-15(11-16)12-20(23)24;2*1-2/h2-8,11,14,19H,9-10,12-13H2,1H3,(H,23,24);2*1H2 |
| InChIKey | WYGKLQGHKTXHLX-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.45 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |