C20H23NO4S — CID 24862857
2-[3-[1-(4-methylphenyl)sulfonylpiperidin-3-yl]phenyl]acetic acid (PubChem CID 24862857) has the molecular formula C20H23NO4S and a molecular weight of 373.47 g/mol. Its IUPAC name is 2-[3-[1-(4-methylphenyl)sulfonylpiperidin-3-yl]phenyl]acetic acid.
| Compound Name | 2-[3-[1-(4-methylphenyl)sulfonylpiperidin-3-yl]phenyl]acetic acid |
|---|---|
| PubChem CID | 24862857 |
| Molecular Formula | C20H23NO4S |
| Molecular Weight | 373.47 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | 2-[3-[1-(4-methylphenyl)sulfonylpiperidin-3-yl]phenyl]acetic acid |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCC(c3cccc(CC(=O)O)c3)C2)cc1 |
| InChI | InChI=1S/C20H23NO4S/c1-15-7-9-19(10-8-15)26(24,25)21-11-3-6-18(14-21)17-5-2-4-16(12-17)13-20(22)23/h2,4-5,7-10,12,18H,3,6,11,13-14H2,1H3,(H,22,23) |
| InChIKey | ZFKASMUAVGQSBP-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.47 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |