C20H23NO6S2 — CID 24863427
2-[3-[1-(4-methylsulfonylphenyl)sulfonylpiperidin-3-yl]phenyl]acetic acid (PubChem CID 24863427) has the molecular formula C20H23NO6S2 and a molecular weight of 437.54 g/mol. Its IUPAC name is 2-[3-[1-(4-methylsulfonylphenyl)sulfonylpiperidin-3-yl]phenyl]acetic acid.
| Compound Name | 2-[3-[1-(4-methylsulfonylphenyl)sulfonylpiperidin-3-yl]phenyl]acetic acid |
|---|---|
| PubChem CID | 24863427 |
| Molecular Formula | C20H23NO6S2 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | 2-[3-[1-(4-methylsulfonylphenyl)sulfonylpiperidin-3-yl]phenyl]acetic acid |
| SMILES | CS(=O)(=O)c1ccc(S(=O)(=O)N2CCCC(c3cccc(CC(=O)O)c3)C2)cc1 |
| InChI | InChI=1S/C20H23NO6S2/c1-28(24,25)18-7-9-19(10-8-18)29(26,27)21-11-3-6-17(14-21)16-5-2-4-15(12-16)13-20(22)23/h2,4-5,7-10,12,17H,3,6,11,13-14H2,1H3,(H,22,23) |
| InChIKey | CIEJVOUGNOCTQW-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 108.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |