C18H16FNO — CID 129394418
(1S,2R)-2-amino-2-(4-fluorophenyl)-1-naphthalen-1-ylethanol (PubChem CID 129394418) has the molecular formula C18H16FNO and a molecular weight of 281.33 g/mol. Its IUPAC name is (1S,2R)-2-amino-2-(4-fluorophenyl)-1-naphthalen-1-ylethanol.
| Compound Name | (1S,2R)-2-amino-2-(4-fluorophenyl)-1-naphthalen-1-ylethanol |
|---|---|
| PubChem CID | 129394418 |
| Molecular Formula | C18H16FNO |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | (1S,2R)-2-amino-2-(4-fluorophenyl)-1-naphthalen-1-ylethanol |
| SMILES | N[C@H](c1ccc(F)cc1)[C@@H](O)c1cccc2ccccc12 |
| InChI | InChI=1S/C18H16FNO/c19-14-10-8-13(9-11-14)17(20)18(21)16-7-3-5-12-4-1-2-6-15(12)16/h1-11,17-18,21H,20H2/t17-,18+/m1/s1 |
| InChIKey | HYXOOKCCWIVILZ-MSOLQXFVSA-N |
| XLogP | 3.71 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |