C14H16N2O3S2 — CID 129399729
[(3R,4R)-1-pyridin-3-ylsulfonyl-4-thiophen-3-ylpyrrolidin-3-yl]methanol (PubChem CID 129399729) has the molecular formula C14H16N2O3S2 and a molecular weight of 324.43 g/mol. Its IUPAC name is [(3R,4R)-1-pyridin-3-ylsulfonyl-4-thiophen-3-ylpyrrolidin-3-yl]methanol.
| Compound Name | [(3R,4R)-1-pyridin-3-ylsulfonyl-4-thiophen-3-ylpyrrolidin-3-yl]methanol |
|---|---|
| PubChem CID | 129399729 |
| Molecular Formula | C14H16N2O3S2 |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | [(3R,4R)-1-pyridin-3-ylsulfonyl-4-thiophen-3-ylpyrrolidin-3-yl]methanol |
| SMILES | O=S(=O)(c1cccnc1)N1C[C@H](CO)[C@H](c2ccsc2)C1 |
| InChI | InChI=1S/C14H16N2O3S2/c17-9-12-7-16(8-14(12)11-3-5-20-10-11)21(18,19)13-2-1-4-15-6-13/h1-6,10,12,14,17H,7-9H2/t12-,14+/m1/s1 |
| InChIKey | IWQRMMAHTFIQNP-OCCSQVGLSA-N |
| XLogP | 1.54 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |