About [(3R,4S)-1-[1-(oxan-4-yl)pyrazol-4-yl]sulfonyl-4-thiophen-3-ylpyrrolidin-3-yl]methanol
[(3R,4S)-1-[1-(oxan-4-yl)pyrazol-4-yl]sulfonyl-4-thiophen-3-ylpyrrolidin-3-yl]methanol (PubChem CID 129399726) has the molecular formula C17H23N3O4S2
and a molecular weight of 397.52 g/mol. Its IUPAC name is [(3R,4S)-1-[1-(oxan-4-yl)pyrazol-4-yl]sulfonyl-4-thiophen-3-ylpyrrolidin-3-yl]methanol.
Molecular Properties
| Compound Name | [(3R,4S)-1-[1-(oxan-4-yl)pyrazol-4-yl]sulfonyl-4-thiophen-3-ylpyrrolidin-3-yl]methanol |
| PubChem CID | 129399726 |
| Molecular Formula | C17H23N3O4S2 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | [(3R,4S)-1-[1-(oxan-4-yl)pyrazol-4-yl]sulfonyl-4-thiophen-3-ylpyrrolidin-3-yl]methanol |
| SMILES | O=S(=O)(c1cnn(C2CCOCC2)c1)N1C[C@H](CO)[C@@H](c2ccsc2)C1 |
| InChI | InChI=1S/C17H23N3O4S2/c21-11-14-8-19(10-17(14)13-3-6-25-12-13)26(22,23)16-7-18-20(9-16)15-1-4-24-5-2-15/h3,6-7,9,12,14-15,17,21H,1-2,4-5,8,10-11H2/t14-,17-/m1/s1 |
| InChIKey | TYAHHBICUQCPTQ-RHSMWYFYSA-N |
| XLogP | 1.69 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [(3R,4S)-1-[1-(oxan-4-yl)pyrazol-4-yl]sulfonyl-4-thiophen-3-ylpyrrolidin-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R,4S)-1-[1-(oxan-4-yl)pyrazol-4-yl]sulfonyl-4-thiophen-3-ylpyrrolidin-3-yl]methanol?
The IUPAC name of [(3R,4S)-1-[1-(oxan-4-yl)pyrazol-4-yl]sulfonyl-4-thiophen-3-ylpyrrolidin-3-yl]methanol (CID 129399726) is [(3R,4S)-1-[1-(oxan-4-yl)pyrazol-4-yl]sulfonyl-4-thiophen-3-ylpyrrolidin-3-yl]methanol.
What is the SMILES notation for [(3R,4S)-1-[1-(oxan-4-yl)pyrazol-4-yl]sulfonyl-4-thiophen-3-ylpyrrolidin-3-yl]methanol?
The canonical SMILES for [(3R,4S)-1-[1-(oxan-4-yl)pyrazol-4-yl]sulfonyl-4-thiophen-3-ylpyrrolidin-3-yl]methanol is O=S(=O)(c1cnn(C2CCOCC2)c1)N1C[C@H](CO)[C@@H](c2ccsc2)C1.
What is the InChIKey of [(3R,4S)-1-[1-(oxan-4-yl)pyrazol-4-yl]sulfonyl-4-thiophen-3-ylpyrrolidin-3-yl]methanol?
The InChIKey is TYAHHBICUQCPTQ-RHSMWYFYSA-N. The full InChI is InChI=1S/C17H23N3O4S2/c21-11-14-8-19(10-17(14)13-3-6-25-12-13)26(22,23)16-7-18-20(9-16)15-1-4-24-5-2-15/h3,6-7,9,12,14-15,17,21H,1-2,4-5,8,10-11H2/t14-,17-/m1/s1.
What are the key properties of [(3R,4S)-1-[1-(oxan-4-yl)pyrazol-4-yl]sulfonyl-4-thiophen-3-ylpyrrolidin-3-yl]methanol?
[(3R,4S)-1-[1-(oxan-4-yl)pyrazol-4-yl]sulfonyl-4-thiophen-3-ylpyrrolidin-3-yl]methanol has a molecular weight of 397.52 g/mol, XLogP of 1.69, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,4S)-1-[1-(oxan-4-yl)pyrazol-4-yl]sulfonyl-4-thiophen-3-ylpyrrolidin-3-yl]methanol is sourced from PubChem (CID 129399726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).