C15H24N2O3S2 — CID 129430131
[(3S,4R)-1-(azepan-1-ylsulfonyl)-4-thiophen-3-ylpyrrolidin-3-yl]methanol (PubChem CID 129430131) has the molecular formula C15H24N2O3S2 and a molecular weight of 344.50 g/mol. Its IUPAC name is [(3S,4R)-1-(azepan-1-ylsulfonyl)-4-thiophen-3-ylpyrrolidin-3-yl]methanol.
| Compound Name | [(3S,4R)-1-(azepan-1-ylsulfonyl)-4-thiophen-3-ylpyrrolidin-3-yl]methanol |
|---|---|
| PubChem CID | 129430131 |
| Molecular Formula | C15H24N2O3S2 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | [(3S,4R)-1-(azepan-1-ylsulfonyl)-4-thiophen-3-ylpyrrolidin-3-yl]methanol |
| SMILES | O=S(=O)(N1CCCCCC1)N1C[C@@H](CO)[C@H](c2ccsc2)C1 |
| InChI | InChI=1S/C15H24N2O3S2/c18-11-14-9-17(10-15(14)13-5-8-21-12-13)22(19,20)16-6-3-1-2-4-7-16/h5,8,12,14-15,18H,1-4,6-7,9-11H2/t14-,15-/m0/s1 |
| InChIKey | ZTPRGUDDGOXIPT-GJZGRUSLSA-N |
| XLogP | 1.88 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |