About [(3S,4R)-1-(azepan-1-ylsulfonyl)-4-thiophen-3-ylpyrrolidin-3-yl]methanol
[(3S,4R)-1-(azepan-1-ylsulfonyl)-4-thiophen-3-ylpyrrolidin-3-yl]methanol (PubChem CID 129430131) has the molecular formula C15H24N2O3S2
and a molecular weight of 344.50 g/mol. Its IUPAC name is [(3S,4R)-1-(azepan-1-ylsulfonyl)-4-thiophen-3-ylpyrrolidin-3-yl]methanol.
Molecular Properties
| Compound Name | [(3S,4R)-1-(azepan-1-ylsulfonyl)-4-thiophen-3-ylpyrrolidin-3-yl]methanol |
| PubChem CID | 129430131 |
| Molecular Formula | C15H24N2O3S2 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | [(3S,4R)-1-(azepan-1-ylsulfonyl)-4-thiophen-3-ylpyrrolidin-3-yl]methanol |
| SMILES | O=S(=O)(N1CCCCCC1)N1C[C@@H](CO)[C@H](c2ccsc2)C1 |
| InChI | InChI=1S/C15H24N2O3S2/c18-11-14-9-17(10-15(14)13-5-8-21-12-13)22(19,20)16-6-3-1-2-4-7-16/h5,8,12,14-15,18H,1-4,6-7,9-11H2/t14-,15-/m0/s1 |
| InChIKey | ZTPRGUDDGOXIPT-GJZGRUSLSA-N |
| XLogP | 1.88 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(3S,4R)-1-(azepan-1-ylsulfonyl)-4-thiophen-3-ylpyrrolidin-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S,4R)-1-(azepan-1-ylsulfonyl)-4-thiophen-3-ylpyrrolidin-3-yl]methanol?
The IUPAC name of [(3S,4R)-1-(azepan-1-ylsulfonyl)-4-thiophen-3-ylpyrrolidin-3-yl]methanol (CID 129430131) is [(3S,4R)-1-(azepan-1-ylsulfonyl)-4-thiophen-3-ylpyrrolidin-3-yl]methanol.
What is the SMILES notation for [(3S,4R)-1-(azepan-1-ylsulfonyl)-4-thiophen-3-ylpyrrolidin-3-yl]methanol?
The canonical SMILES for [(3S,4R)-1-(azepan-1-ylsulfonyl)-4-thiophen-3-ylpyrrolidin-3-yl]methanol is O=S(=O)(N1CCCCCC1)N1C[C@@H](CO)[C@H](c2ccsc2)C1.
What is the InChIKey of [(3S,4R)-1-(azepan-1-ylsulfonyl)-4-thiophen-3-ylpyrrolidin-3-yl]methanol?
The InChIKey is ZTPRGUDDGOXIPT-GJZGRUSLSA-N. The full InChI is InChI=1S/C15H24N2O3S2/c18-11-14-9-17(10-15(14)13-5-8-21-12-13)22(19,20)16-6-3-1-2-4-7-16/h5,8,12,14-15,18H,1-4,6-7,9-11H2/t14-,15-/m0/s1.
What are the key properties of [(3S,4R)-1-(azepan-1-ylsulfonyl)-4-thiophen-3-ylpyrrolidin-3-yl]methanol?
[(3S,4R)-1-(azepan-1-ylsulfonyl)-4-thiophen-3-ylpyrrolidin-3-yl]methanol has a molecular weight of 344.50 g/mol, XLogP of 1.88, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S,4R)-1-(azepan-1-ylsulfonyl)-4-thiophen-3-ylpyrrolidin-3-yl]methanol is sourced from PubChem (CID 129430131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).