About [(3R,4S)-1-(3-methoxythiophen-2-yl)sulfonyl-4-thiophen-3-ylpyrrolidin-3-yl]methanol
[(3R,4S)-1-(3-methoxythiophen-2-yl)sulfonyl-4-thiophen-3-ylpyrrolidin-3-yl]methanol (PubChem CID 129430128) has the molecular formula C14H17NO4S3
and a molecular weight of 359.49 g/mol. Its IUPAC name is [(3R,4S)-1-(3-methoxythiophen-2-yl)sulfonyl-4-thiophen-3-ylpyrrolidin-3-yl]methanol.
Molecular Properties
| Compound Name | [(3R,4S)-1-(3-methoxythiophen-2-yl)sulfonyl-4-thiophen-3-ylpyrrolidin-3-yl]methanol |
| PubChem CID | 129430128 |
| Molecular Formula | C14H17NO4S3 |
| Molecular Weight | 359.49 g/mol |
| Exact Mass | 359.03 |
| IUPAC Name | [(3R,4S)-1-(3-methoxythiophen-2-yl)sulfonyl-4-thiophen-3-ylpyrrolidin-3-yl]methanol |
| SMILES | COc1ccsc1S(=O)(=O)N1C[C@H](CO)[C@@H](c2ccsc2)C1 |
| InChI | InChI=1S/C14H17NO4S3/c1-19-13-3-5-21-14(13)22(17,18)15-6-11(8-16)12(7-15)10-2-4-20-9-10/h2-5,9,11-12,16H,6-8H2,1H3/t11-,12-/m1/s1 |
| InChIKey | YHPKWZHXZBWTPA-VXGBXAGGSA-N |
| XLogP | 2.21 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.49 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [(3R,4S)-1-(3-methoxythiophen-2-yl)sulfonyl-4-thiophen-3-ylpyrrolidin-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R,4S)-1-(3-methoxythiophen-2-yl)sulfonyl-4-thiophen-3-ylpyrrolidin-3-yl]methanol?
The IUPAC name of [(3R,4S)-1-(3-methoxythiophen-2-yl)sulfonyl-4-thiophen-3-ylpyrrolidin-3-yl]methanol (CID 129430128) is [(3R,4S)-1-(3-methoxythiophen-2-yl)sulfonyl-4-thiophen-3-ylpyrrolidin-3-yl]methanol.
What is the SMILES notation for [(3R,4S)-1-(3-methoxythiophen-2-yl)sulfonyl-4-thiophen-3-ylpyrrolidin-3-yl]methanol?
The canonical SMILES for [(3R,4S)-1-(3-methoxythiophen-2-yl)sulfonyl-4-thiophen-3-ylpyrrolidin-3-yl]methanol is COc1ccsc1S(=O)(=O)N1C[C@H](CO)[C@@H](c2ccsc2)C1.
What is the InChIKey of [(3R,4S)-1-(3-methoxythiophen-2-yl)sulfonyl-4-thiophen-3-ylpyrrolidin-3-yl]methanol?
The InChIKey is YHPKWZHXZBWTPA-VXGBXAGGSA-N. The full InChI is InChI=1S/C14H17NO4S3/c1-19-13-3-5-21-14(13)22(17,18)15-6-11(8-16)12(7-15)10-2-4-20-9-10/h2-5,9,11-12,16H,6-8H2,1H3/t11-,12-/m1/s1.
What are the key properties of [(3R,4S)-1-(3-methoxythiophen-2-yl)sulfonyl-4-thiophen-3-ylpyrrolidin-3-yl]methanol?
[(3R,4S)-1-(3-methoxythiophen-2-yl)sulfonyl-4-thiophen-3-ylpyrrolidin-3-yl]methanol has a molecular weight of 359.49 g/mol, XLogP of 2.21, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,4S)-1-(3-methoxythiophen-2-yl)sulfonyl-4-thiophen-3-ylpyrrolidin-3-yl]methanol is sourced from PubChem (CID 129430128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).