About [(3R,4S)-1-(3-fluoro-4-methoxyphenyl)sulfonyl-4-thiophen-3-ylpyrrolidin-3-yl]methanol
[(3R,4S)-1-(3-fluoro-4-methoxyphenyl)sulfonyl-4-thiophen-3-ylpyrrolidin-3-yl]methanol (PubChem CID 129430108) has the molecular formula C16H18FNO4S2
and a molecular weight of 371.46 g/mol. Its IUPAC name is [(3R,4S)-1-(3-fluoro-4-methoxyphenyl)sulfonyl-4-thiophen-3-ylpyrrolidin-3-yl]methanol.
Molecular Properties
| Compound Name | [(3R,4S)-1-(3-fluoro-4-methoxyphenyl)sulfonyl-4-thiophen-3-ylpyrrolidin-3-yl]methanol |
| PubChem CID | 129430108 |
| Molecular Formula | C16H18FNO4S2 |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | [(3R,4S)-1-(3-fluoro-4-methoxyphenyl)sulfonyl-4-thiophen-3-ylpyrrolidin-3-yl]methanol |
| SMILES | COc1ccc(S(=O)(=O)N2C[C@H](CO)[C@@H](c3ccsc3)C2)cc1F |
| InChI | InChI=1S/C16H18FNO4S2/c1-22-16-3-2-13(6-15(16)17)24(20,21)18-7-12(9-19)14(8-18)11-4-5-23-10-11/h2-6,10,12,14,19H,7-9H2,1H3/t12-,14-/m1/s1 |
| InChIKey | UGUUGQTUAPRGLH-TZMCWYRMSA-N |
| XLogP | 2.29 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(3R,4S)-1-(3-fluoro-4-methoxyphenyl)sulfonyl-4-thiophen-3-ylpyrrolidin-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R,4S)-1-(3-fluoro-4-methoxyphenyl)sulfonyl-4-thiophen-3-ylpyrrolidin-3-yl]methanol?
The IUPAC name of [(3R,4S)-1-(3-fluoro-4-methoxyphenyl)sulfonyl-4-thiophen-3-ylpyrrolidin-3-yl]methanol (CID 129430108) is [(3R,4S)-1-(3-fluoro-4-methoxyphenyl)sulfonyl-4-thiophen-3-ylpyrrolidin-3-yl]methanol.
What is the SMILES notation for [(3R,4S)-1-(3-fluoro-4-methoxyphenyl)sulfonyl-4-thiophen-3-ylpyrrolidin-3-yl]methanol?
The canonical SMILES for [(3R,4S)-1-(3-fluoro-4-methoxyphenyl)sulfonyl-4-thiophen-3-ylpyrrolidin-3-yl]methanol is COc1ccc(S(=O)(=O)N2C[C@H](CO)[C@@H](c3ccsc3)C2)cc1F.
What is the InChIKey of [(3R,4S)-1-(3-fluoro-4-methoxyphenyl)sulfonyl-4-thiophen-3-ylpyrrolidin-3-yl]methanol?
The InChIKey is UGUUGQTUAPRGLH-TZMCWYRMSA-N. The full InChI is InChI=1S/C16H18FNO4S2/c1-22-16-3-2-13(6-15(16)17)24(20,21)18-7-12(9-19)14(8-18)11-4-5-23-10-11/h2-6,10,12,14,19H,7-9H2,1H3/t12-,14-/m1/s1.
What are the key properties of [(3R,4S)-1-(3-fluoro-4-methoxyphenyl)sulfonyl-4-thiophen-3-ylpyrrolidin-3-yl]methanol?
[(3R,4S)-1-(3-fluoro-4-methoxyphenyl)sulfonyl-4-thiophen-3-ylpyrrolidin-3-yl]methanol has a molecular weight of 371.46 g/mol, XLogP of 2.29, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,4S)-1-(3-fluoro-4-methoxyphenyl)sulfonyl-4-thiophen-3-ylpyrrolidin-3-yl]methanol is sourced from PubChem (CID 129430108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).