About 4-[(3S,4R)-3-(hydroxymethyl)-4-thiophen-3-ylpyrrolidin-1-yl]sulfonylbenzamide
4-[(3S,4R)-3-(hydroxymethyl)-4-thiophen-3-ylpyrrolidin-1-yl]sulfonylbenzamide (PubChem CID 129472794) has the molecular formula C16H18N2O4S2
and a molecular weight of 366.46 g/mol. Its IUPAC name is 4-[(3S,4R)-3-(hydroxymethyl)-4-thiophen-3-ylpyrrolidin-1-yl]sulfonylbenzamide.
Molecular Properties
| Compound Name | 4-[(3S,4R)-3-(hydroxymethyl)-4-thiophen-3-ylpyrrolidin-1-yl]sulfonylbenzamide |
| PubChem CID | 129472794 |
| Molecular Formula | C16H18N2O4S2 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | 4-[(3S,4R)-3-(hydroxymethyl)-4-thiophen-3-ylpyrrolidin-1-yl]sulfonylbenzamide |
| SMILES | NC(=O)c1ccc(S(=O)(=O)N2C[C@@H](CO)[C@H](c3ccsc3)C2)cc1 |
| InChI | InChI=1S/C16H18N2O4S2/c17-16(20)11-1-3-14(4-2-11)24(21,22)18-7-13(9-19)15(8-18)12-5-6-23-10-12/h1-6,10,13,15,19H,7-9H2,(H2,17,20)/t13-,15-/m0/s1 |
| InChIKey | WCMMCTPFBGBPHY-ZFWWWQNUSA-N |
| XLogP | 1.24 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[(3S,4R)-3-(hydroxymethyl)-4-thiophen-3-ylpyrrolidin-1-yl]sulfonylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3S,4R)-3-(hydroxymethyl)-4-thiophen-3-ylpyrrolidin-1-yl]sulfonylbenzamide?
The IUPAC name of 4-[(3S,4R)-3-(hydroxymethyl)-4-thiophen-3-ylpyrrolidin-1-yl]sulfonylbenzamide (CID 129472794) is 4-[(3S,4R)-3-(hydroxymethyl)-4-thiophen-3-ylpyrrolidin-1-yl]sulfonylbenzamide.
What is the SMILES notation for 4-[(3S,4R)-3-(hydroxymethyl)-4-thiophen-3-ylpyrrolidin-1-yl]sulfonylbenzamide?
The canonical SMILES for 4-[(3S,4R)-3-(hydroxymethyl)-4-thiophen-3-ylpyrrolidin-1-yl]sulfonylbenzamide is NC(=O)c1ccc(S(=O)(=O)N2C[C@@H](CO)[C@H](c3ccsc3)C2)cc1.
What is the InChIKey of 4-[(3S,4R)-3-(hydroxymethyl)-4-thiophen-3-ylpyrrolidin-1-yl]sulfonylbenzamide?
The InChIKey is WCMMCTPFBGBPHY-ZFWWWQNUSA-N. The full InChI is InChI=1S/C16H18N2O4S2/c17-16(20)11-1-3-14(4-2-11)24(21,22)18-7-13(9-19)15(8-18)12-5-6-23-10-12/h1-6,10,13,15,19H,7-9H2,(H2,17,20)/t13-,15-/m0/s1.
What are the key properties of 4-[(3S,4R)-3-(hydroxymethyl)-4-thiophen-3-ylpyrrolidin-1-yl]sulfonylbenzamide?
4-[(3S,4R)-3-(hydroxymethyl)-4-thiophen-3-ylpyrrolidin-1-yl]sulfonylbenzamide has a molecular weight of 366.46 g/mol, XLogP of 1.24, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3S,4R)-3-(hydroxymethyl)-4-thiophen-3-ylpyrrolidin-1-yl]sulfonylbenzamide is sourced from PubChem (CID 129472794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).