C19H26N4O2 — CID 129401216
N-[[(3R)-1-(3-methoxyphenyl)pyrrolidin-3-yl]methyl]-1-propan-2-ylpyrazole-4-carboxamide (PubChem CID 129401216) has the molecular formula C19H26N4O2 and a molecular weight of 342.44 g/mol. Its IUPAC name is N-[[(3R)-1-(3-methoxyphenyl)pyrrolidin-3-yl]methyl]-1-propan-2-ylpyrazole-4-carboxamide.
| Compound Name | N-[[(3R)-1-(3-methoxyphenyl)pyrrolidin-3-yl]methyl]-1-propan-2-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 129401216 |
| Molecular Formula | C19H26N4O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | N-[[(3R)-1-(3-methoxyphenyl)pyrrolidin-3-yl]methyl]-1-propan-2-ylpyrazole-4-carboxamide |
| SMILES | COc1cccc(N2CC[C@H](CNC(=O)c3cnn(C(C)C)c3)C2)c1 |
| InChI | InChI=1S/C19H26N4O2/c1-14(2)23-13-16(11-21-23)19(24)20-10-15-7-8-22(12-15)17-5-4-6-18(9-17)25-3/h4-6,9,11,13-15H,7-8,10,12H2,1-3H3,(H,20,24)/t15-/m1/s1 |
| InChIKey | NLNIQCVJSANWBZ-OAHLLOKOSA-N |
| XLogP | 2.73 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |