C15H18O2 — CID 129404936
(2S)-2-cyclohexyl-2,3-dihydro-1-benzofuran-5-carbaldehyde (PubChem CID 129404936) has the molecular formula C15H18O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is (2S)-2-cyclohexyl-2,3-dihydro-1-benzofuran-5-carbaldehyde.
| Compound Name | (2S)-2-cyclohexyl-2,3-dihydro-1-benzofuran-5-carbaldehyde |
|---|---|
| PubChem CID | 129404936 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | (2S)-2-cyclohexyl-2,3-dihydro-1-benzofuran-5-carbaldehyde |
| SMILES | O=Cc1ccc2c(c1)C[C@@H](C1CCCCC1)O2 |
| InChI | InChI=1S/C15H18O2/c16-10-11-6-7-14-13(8-11)9-15(17-14)12-4-2-1-3-5-12/h6-8,10,12,15H,1-5,9H2/t15-/m0/s1 |
| InChIKey | HZGONLSLBGLMOA-HNNXBMFYSA-N |
| XLogP | 3.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|