C15H18O3S — CID 129410508
(2R)-3-acetylsulfanyl-2-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]propanoic acid (PubChem CID 129410508) has the molecular formula C15H18O3S and a molecular weight of 278.37 g/mol. Its IUPAC name is (2R)-3-acetylsulfanyl-2-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]propanoic acid.
| Compound Name | (2R)-3-acetylsulfanyl-2-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]propanoic acid |
|---|---|
| PubChem CID | 129410508 |
| Molecular Formula | C15H18O3S |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | (2R)-3-acetylsulfanyl-2-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]propanoic acid |
| SMILES | CC(=O)SC[C@@H](C(=O)O)[C@@H]1CCCc2ccccc21 |
| InChI | InChI=1S/C15H18O3S/c1-10(16)19-9-14(15(17)18)13-8-4-6-11-5-2-3-7-12(11)13/h2-3,5,7,13-14H,4,6,8-9H2,1H3,(H,17,18)/t13-,14-/m1/s1 |
| InChIKey | VANHGGWYCKWJTE-ZIAGYGMSSA-N |
| XLogP | 3.09 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|