C14H16O4 — CID 23057353
2-(1,2,3,4-tetrahydronaphthalen-1-yl)butanedioic acid (PubChem CID 23057353) has the molecular formula C14H16O4 and a molecular weight of 248.28 g/mol. Its IUPAC name is 2-(1,2,3,4-tetrahydronaphthalen-1-yl)butanedioic acid.
| Compound Name | 2-(1,2,3,4-tetrahydronaphthalen-1-yl)butanedioic acid |
|---|---|
| PubChem CID | 23057353 |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 2-(1,2,3,4-tetrahydronaphthalen-1-yl)butanedioic acid |
| SMILES | O=C(O)CC(C(=O)O)C1CCCc2ccccc21 |
| InChI | InChI=1S/C14H16O4/c15-13(16)8-12(14(17)18)11-7-3-5-9-4-1-2-6-10(9)11/h1-2,4,6,11-12H,3,5,7-8H2,(H,15,16)(H,17,18) |
| InChIKey | PAYVNGLXRRKQEG-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |