2-(1,2,3,4-tetrahydronaphthalen-1-yl)butanedioic acid

C14H16O4 — CID 23057353

IUPAC2-(1,2,3,4-tetrahydronaphthalen-1-yl)butanedioic acid
SMILESO=C(O)CC(C(=O)O)C1CCCc2ccccc21
InChIInChI=1S/C14H16O4/c15-13(16)8-12(14(17)18)11-7-3-5-9-4-1-2-6-10(9)11/h1-2,4,6,11-12H,3,5,7-8H2,(H,15,16)(H,17,18)
InChIKeyPAYVNGLXRRKQEG-UHFFFAOYSA-N
MW248.28 g/mol
LogP2.28
Rot. Bonds4

About 2-(1,2,3,4-tetrahydronaphthalen-1-yl)butanedioic acid

2-(1,2,3,4-tetrahydronaphthalen-1-yl)butanedioic acid (PubChem CID 23057353) has the molecular formula C14H16O4 and a molecular weight of 248.28 g/mol. Its IUPAC name is 2-(1,2,3,4-tetrahydronaphthalen-1-yl)butanedioic acid.

Molecular Properties

Compound Name2-(1,2,3,4-tetrahydronaphthalen-1-yl)butanedioic acid
PubChem CID23057353
Molecular FormulaC14H16O4
Molecular Weight248.28 g/mol
Exact Mass248.10
IUPAC Name2-(1,2,3,4-tetrahydronaphthalen-1-yl)butanedioic acid
SMILESO=C(O)CC(C(=O)O)C1CCCc2ccccc21
InChIInChI=1S/C14H16O4/c15-13(16)8-12(14(17)18)11-7-3-5-9-4-1-2-6-10(9)11/h1-2,4,6,11-12H,3,5,7-8H2,(H,15,16)(H,17,18)
InChIKeyPAYVNGLXRRKQEG-UHFFFAOYSA-N
XLogP2.28
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500248.28
LogP ≤ 52.28
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-(1,2,3,4-tetrahydronaphthalen-1-yl)butanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1,2,3,4-tetrahydronaphthalen-1-yl)butanedioic acid?
The IUPAC name of 2-(1,2,3,4-tetrahydronaphthalen-1-yl)butanedioic acid (CID 23057353) is 2-(1,2,3,4-tetrahydronaphthalen-1-yl)butanedioic acid.
What is the SMILES notation for 2-(1,2,3,4-tetrahydronaphthalen-1-yl)butanedioic acid?
The canonical SMILES for 2-(1,2,3,4-tetrahydronaphthalen-1-yl)butanedioic acid is O=C(O)CC(C(=O)O)C1CCCc2ccccc21.
What is the InChIKey of 2-(1,2,3,4-tetrahydronaphthalen-1-yl)butanedioic acid?
The InChIKey is PAYVNGLXRRKQEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16O4/c15-13(16)8-12(14(17)18)11-7-3-5-9-4-1-2-6-10(9)11/h1-2,4,6,11-12H,3,5,7-8H2,(H,15,16)(H,17,18).
What are the key properties of 2-(1,2,3,4-tetrahydronaphthalen-1-yl)butanedioic acid?
2-(1,2,3,4-tetrahydronaphthalen-1-yl)butanedioic acid has a molecular weight of 248.28 g/mol, XLogP of 2.28, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,2,3,4-tetrahydronaphthalen-1-yl)butanedioic acid is sourced from PubChem (CID 23057353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).