C11H13ClO — CID 129411297
(1R,2S)-4-chloro-2,6-dimethyl-2,3-dihydro-1H-inden-1-ol (PubChem CID 129411297) has the molecular formula C11H13ClO and a molecular weight of 196.68 g/mol. Its IUPAC name is (1R,2S)-4-chloro-2,6-dimethyl-2,3-dihydro-1H-inden-1-ol.
| Compound Name | (1R,2S)-4-chloro-2,6-dimethyl-2,3-dihydro-1H-inden-1-ol |
|---|---|
| PubChem CID | 129411297 |
| Molecular Formula | C11H13ClO |
| Molecular Weight | 196.68 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | (1R,2S)-4-chloro-2,6-dimethyl-2,3-dihydro-1H-inden-1-ol |
| SMILES | Cc1cc(Cl)c2c(c1)[C@H](O)[C@@H](C)C2 |
| InChI | InChI=1S/C11H13ClO/c1-6-3-9-8(10(12)4-6)5-7(2)11(9)13/h3-4,7,11,13H,5H2,1-2H3/t7-,11+/m0/s1 |
| InChIKey | XRQOIAXUPJMKQU-WRWORJQWSA-N |
| XLogP | 2.87 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.68 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |