C10H9BrCl2 — CID 79726788
1-bromo-4,6-dichloro-2-methyl-2,3-dihydro-1H-indene (PubChem CID 79726788) has the molecular formula C10H9BrCl2 and a molecular weight of 279.99 g/mol. Its IUPAC name is 1-bromo-4,6-dichloro-2-methyl-2,3-dihydro-1H-indene.
| Compound Name | 1-bromo-4,6-dichloro-2-methyl-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 79726788 |
| Molecular Formula | C10H9BrCl2 |
| Molecular Weight | 279.99 g/mol |
| Exact Mass | 277.93 |
| IUPAC Name | 1-bromo-4,6-dichloro-2-methyl-2,3-dihydro-1H-indene |
| SMILES | CC1Cc2c(Cl)cc(Cl)cc2C1Br |
| InChI | InChI=1S/C10H9BrCl2/c1-5-2-7-8(10(5)11)3-6(12)4-9(7)13/h3-5,10H,2H2,1H3 |
| InChIKey | PFJFWSDIIYACDO-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.99 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|