About 1-bromo-4,6-dichloro-2-methyl-2,3-dihydro-1H-indene
1-bromo-4,6-dichloro-2-methyl-2,3-dihydro-1H-indene (PubChem CID 79726788) has the molecular formula C10H9BrCl2
and a molecular weight of 279.99 g/mol. Its IUPAC name is 1-bromo-4,6-dichloro-2-methyl-2,3-dihydro-1H-indene.
Molecular Properties
| Compound Name | 1-bromo-4,6-dichloro-2-methyl-2,3-dihydro-1H-indene |
| PubChem CID | 79726788 |
| Molecular Formula | C10H9BrCl2 |
| Molecular Weight | 279.99 g/mol |
| Exact Mass | 277.93 |
| IUPAC Name | 1-bromo-4,6-dichloro-2-methyl-2,3-dihydro-1H-indene |
| SMILES | CC1Cc2c(Cl)cc(Cl)cc2C1Br |
| InChI | InChI=1S/C10H9BrCl2/c1-5-2-7-8(10(5)11)3-6(12)4-9(7)13/h3-5,10H,2H2,1H3 |
| InChIKey | PFJFWSDIIYACDO-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.99 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-4,6-dichloro-2-methyl-2,3-dihydro-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-4,6-dichloro-2-methyl-2,3-dihydro-1H-indene?
The IUPAC name of 1-bromo-4,6-dichloro-2-methyl-2,3-dihydro-1H-indene (CID 79726788) is 1-bromo-4,6-dichloro-2-methyl-2,3-dihydro-1H-indene.
What is the SMILES notation for 1-bromo-4,6-dichloro-2-methyl-2,3-dihydro-1H-indene?
The canonical SMILES for 1-bromo-4,6-dichloro-2-methyl-2,3-dihydro-1H-indene is CC1Cc2c(Cl)cc(Cl)cc2C1Br.
What is the InChIKey of 1-bromo-4,6-dichloro-2-methyl-2,3-dihydro-1H-indene?
The InChIKey is PFJFWSDIIYACDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9BrCl2/c1-5-2-7-8(10(5)11)3-6(12)4-9(7)13/h3-5,10H,2H2,1H3.
What are the key properties of 1-bromo-4,6-dichloro-2-methyl-2,3-dihydro-1H-indene?
1-bromo-4,6-dichloro-2-methyl-2,3-dihydro-1H-indene has a molecular weight of 279.99 g/mol, XLogP of 4.62, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-4,6-dichloro-2-methyl-2,3-dihydro-1H-indene is sourced from PubChem (CID 79726788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).