C9H6Cl2O — CID 98080535
(1aR,6aR)-3,5-dichloro-6,6a-dihydro-1aH-indeno[1,2-b]oxirene (PubChem CID 98080535) has the molecular formula C9H6Cl2O and a molecular weight of 201.05 g/mol. Its IUPAC name is (1aR,6aR)-3,5-dichloro-6,6a-dihydro-1aH-indeno[1,2-b]oxirene.
| Compound Name | (1aR,6aR)-3,5-dichloro-6,6a-dihydro-1aH-indeno[1,2-b]oxirene |
|---|---|
| PubChem CID | 98080535 |
| Molecular Formula | C9H6Cl2O |
| Molecular Weight | 201.05 g/mol |
| Exact Mass | 199.98 |
| IUPAC Name | (1aR,6aR)-3,5-dichloro-6,6a-dihydro-1aH-indeno[1,2-b]oxirene |
| SMILES | Clc1cc(Cl)c2c(c1)[C@H]1O[C@@H]1C2 |
| InChI | InChI=1S/C9H6Cl2O/c10-4-1-6-5(7(11)2-4)3-8-9(6)12-8/h1-2,8-9H,3H2/t8-,9-/m1/s1 |
| InChIKey | SBSVJEMBNBKHOX-RKDXNWHRSA-N |
| XLogP | 2.99 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.05 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|