C10H9Cl3O — CID 62736021
5,7,9-trichloro-1,2,4,5-tetrahydro-3-benzoxepine (PubChem CID 62736021) has the molecular formula C10H9Cl3O and a molecular weight of 251.54 g/mol. Its IUPAC name is 5,7,9-trichloro-1,2,4,5-tetrahydro-3-benzoxepine.
| Compound Name | 5,7,9-trichloro-1,2,4,5-tetrahydro-3-benzoxepine |
|---|---|
| PubChem CID | 62736021 |
| Molecular Formula | C10H9Cl3O |
| Molecular Weight | 251.54 g/mol |
| Exact Mass | 249.97 |
| IUPAC Name | 5,7,9-trichloro-1,2,4,5-tetrahydro-3-benzoxepine |
| SMILES | Clc1cc(Cl)c2c(c1)C(Cl)COCC2 |
| InChI | InChI=1S/C10H9Cl3O/c11-6-3-8-7(9(12)4-6)1-2-14-5-10(8)13/h3-4,10H,1-2,5H2 |
| InChIKey | PPDRIHKRHXYNNW-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.54 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|