C10H11Cl2NO — CID 62737289
6,9-dichloro-1,2,4,5-tetrahydro-3-benzoxepin-5-amine (PubChem CID 62737289) has the molecular formula C10H11Cl2NO and a molecular weight of 232.11 g/mol. Its IUPAC name is 6,9-dichloro-1,2,4,5-tetrahydro-3-benzoxepin-5-amine.
| Compound Name | 6,9-dichloro-1,2,4,5-tetrahydro-3-benzoxepin-5-amine |
|---|---|
| PubChem CID | 62737289 |
| Molecular Formula | C10H11Cl2NO |
| Molecular Weight | 232.11 g/mol |
| Exact Mass | 231.02 |
| IUPAC Name | 6,9-dichloro-1,2,4,5-tetrahydro-3-benzoxepin-5-amine |
| SMILES | NC1COCCc2c(Cl)ccc(Cl)c21 |
| InChI | InChI=1S/C10H11Cl2NO/c11-7-1-2-8(12)10-6(7)3-4-14-5-9(10)13/h1-2,9H,3-5,13H2 |
| InChIKey | PFIOEEVHJHEHDB-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.11 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |