C10H9BrCl2O — CID 62738240
5-bromo-6,9-dichloro-1,2,4,5-tetrahydro-3-benzoxepine (PubChem CID 62738240) has the molecular formula C10H9BrCl2O and a molecular weight of 295.99 g/mol. Its IUPAC name is 5-bromo-6,9-dichloro-1,2,4,5-tetrahydro-3-benzoxepine.
| Compound Name | 5-bromo-6,9-dichloro-1,2,4,5-tetrahydro-3-benzoxepine |
|---|---|
| PubChem CID | 62738240 |
| Molecular Formula | C10H9BrCl2O |
| Molecular Weight | 295.99 g/mol |
| Exact Mass | 293.92 |
| IUPAC Name | 5-bromo-6,9-dichloro-1,2,4,5-tetrahydro-3-benzoxepine |
| SMILES | Clc1ccc(Cl)c2c1CCOCC2Br |
| InChI | InChI=1S/C10H9BrCl2O/c11-7-5-14-4-3-6-8(12)1-2-9(13)10(6)7/h1-2,7H,3-5H2 |
| InChIKey | OCPWPPBBHWBHDI-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.99 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|