C10H11Cl2NO — CID 43537153
5,8-dichloro-2-methyl-3,4-dihydro-2H-chromen-4-amine (PubChem CID 43537153) has the molecular formula C10H11Cl2NO and a molecular weight of 232.11 g/mol. Its IUPAC name is 5,8-dichloro-2-methyl-3,4-dihydro-2H-chromen-4-amine.
| Compound Name | 5,8-dichloro-2-methyl-3,4-dihydro-2H-chromen-4-amine |
|---|---|
| PubChem CID | 43537153 |
| Molecular Formula | C10H11Cl2NO |
| Molecular Weight | 232.11 g/mol |
| Exact Mass | 231.02 |
| IUPAC Name | 5,8-dichloro-2-methyl-3,4-dihydro-2H-chromen-4-amine |
| SMILES | CC1CC(N)c2c(Cl)ccc(Cl)c2O1 |
| InChI | InChI=1S/C10H11Cl2NO/c1-5-4-8(13)9-6(11)2-3-7(12)10(9)14-5/h2-3,5,8H,4,13H2,1H3 |
| InChIKey | ZDLRQWGNJWQOAW-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.11 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |