C9H10ClNO2 — CID 140990727
6-chloro-3-methyl-2,3-dihydro-1,4-benzodioxin-5-amine (PubChem CID 140990727) has the molecular formula C9H10ClNO2 and a molecular weight of 199.64 g/mol. Its IUPAC name is 6-chloro-3-methyl-2,3-dihydro-1,4-benzodioxin-5-amine.
| Compound Name | 6-chloro-3-methyl-2,3-dihydro-1,4-benzodioxin-5-amine |
|---|---|
| PubChem CID | 140990727 |
| Molecular Formula | C9H10ClNO2 |
| Molecular Weight | 199.64 g/mol |
| Exact Mass | 199.04 |
| IUPAC Name | 6-chloro-3-methyl-2,3-dihydro-1,4-benzodioxin-5-amine |
| SMILES | CC1COc2ccc(Cl)c(N)c2O1 |
| InChI | InChI=1S/C9H10ClNO2/c1-5-4-12-7-3-2-6(10)8(11)9(7)13-5/h2-3,5H,4,11H2,1H3 |
| InChIKey | LNCAFYAREWVNOD-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.64 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|