C19H25FN4 — CID 129433668
1-[(2-fluorophenyl)methyl]-N-[(1S)-1-(3-methylpyrazin-2-yl)ethyl]piperidin-4-amine (PubChem CID 129433668) has the molecular formula C19H25FN4 and a molecular weight of 328.44 g/mol. Its IUPAC name is 1-[(2-fluorophenyl)methyl]-N-[(1S)-1-(3-methylpyrazin-2-yl)ethyl]piperidin-4-amine.
| Compound Name | 1-[(2-fluorophenyl)methyl]-N-[(1S)-1-(3-methylpyrazin-2-yl)ethyl]piperidin-4-amine |
|---|---|
| PubChem CID | 129433668 |
| Molecular Formula | C19H25FN4 |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.21 |
| IUPAC Name | 1-[(2-fluorophenyl)methyl]-N-[(1S)-1-(3-methylpyrazin-2-yl)ethyl]piperidin-4-amine |
| SMILES | Cc1nccnc1[C@H](C)NC1CCN(Cc2ccccc2F)CC1 |
| InChI | InChI=1S/C19H25FN4/c1-14-19(22-10-9-21-14)15(2)23-17-7-11-24(12-8-17)13-16-5-3-4-6-18(16)20/h3-6,9-10,15,17,23H,7-8,11-13H2,1-2H3/t15-/m0/s1 |
| InChIKey | RECHJDNQKBOUMM-HNNXBMFYSA-N |
| XLogP | 3.24 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |