C19H27FN4 — CID 125438218
1-[(2-fluorophenyl)methyl]-N-[(2R)-1-(2-methylimidazol-1-yl)propan-2-yl]piperidin-4-amine (PubChem CID 125438218) has the molecular formula C19H27FN4 and a molecular weight of 330.45 g/mol. Its IUPAC name is 1-[(2-fluorophenyl)methyl]-N-[(2R)-1-(2-methylimidazol-1-yl)propan-2-yl]piperidin-4-amine.
| Compound Name | 1-[(2-fluorophenyl)methyl]-N-[(2R)-1-(2-methylimidazol-1-yl)propan-2-yl]piperidin-4-amine |
|---|---|
| PubChem CID | 125438218 |
| Molecular Formula | C19H27FN4 |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | 1-[(2-fluorophenyl)methyl]-N-[(2R)-1-(2-methylimidazol-1-yl)propan-2-yl]piperidin-4-amine |
| SMILES | Cc1nccn1C[C@@H](C)NC1CCN(Cc2ccccc2F)CC1 |
| InChI | InChI=1S/C19H27FN4/c1-15(13-24-12-9-21-16(24)2)22-18-7-10-23(11-8-18)14-17-5-3-4-6-19(17)20/h3-6,9,12,15,18,22H,7-8,10-11,13-14H2,1-2H3/t15-/m1/s1 |
| InChIKey | ZZHUTRCIYWTGQD-OAHLLOKOSA-N |
| XLogP | 2.97 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |