C24H40N4O2 — CID 12989126
(4S,13S)-4,13-di(butan-2-yl)-3,6,11,14-tetrazabicyclo[14.3.1]icosa-1(20),16,18-triene-5,12-dione (PubChem CID 12989126) has the molecular formula C24H40N4O2 and a molecular weight of 416.61 g/mol. Its IUPAC name is (4S,13S)-4,13-di(butan-2-yl)-3,6,11,14-tetrazabicyclo[14.3.1]icosa-1(20),16,18-triene-5,12-dione.
| Compound Name | (4S,13S)-4,13-di(butan-2-yl)-3,6,11,14-tetrazabicyclo[14.3.1]icosa-1(20),16,18-triene-5,12-dione |
|---|---|
| PubChem CID | 12989126 |
| Molecular Formula | C24H40N4O2 |
| Molecular Weight | 416.61 g/mol |
| Exact Mass | 416.32 |
| IUPAC Name | (4S,13S)-4,13-di(butan-2-yl)-3,6,11,14-tetrazabicyclo[14.3.1]icosa-1(20),16,18-triene-5,12-dione |
| SMILES | CCC(C)[C@@H]1NCc2cccc(c2)CN[C@@H](C(C)CC)C(=O)NCCCCNC1=O |
| InChI | InChI=1S/C24H40N4O2/c1-5-17(3)21-23(29)25-12-7-8-13-26-24(30)22(18(4)6-2)28-16-20-11-9-10-19(14-20)15-27-21/h9-11,14,17-18,21-22,27-28H,5-8,12-13,15-16H2,1-4H3,(H,25,29)(H,26,30)/t17?,18?,21-,22-/m0/s1 |
| InChIKey | DUGZEZXVFVLXIQ-OWXVKCJTSA-N |
| XLogP | 2.72 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.61 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |