C22H26N2O — CID 12994065
5-methyl-1-(1,10-phenanthrolin-2-yl)-2-propan-2-ylcyclohexan-1-ol (PubChem CID 12994065) has the molecular formula C22H26N2O and a molecular weight of 334.46 g/mol. Its IUPAC name is 5-methyl-1-(1,10-phenanthrolin-2-yl)-2-propan-2-ylcyclohexan-1-ol.
| Compound Name | 5-methyl-1-(1,10-phenanthrolin-2-yl)-2-propan-2-ylcyclohexan-1-ol |
|---|---|
| PubChem CID | 12994065 |
| Molecular Formula | C22H26N2O |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | 5-methyl-1-(1,10-phenanthrolin-2-yl)-2-propan-2-ylcyclohexan-1-ol |
| SMILES | CC1CCC(C(C)C)C(O)(c2ccc3ccc4cccnc4c3n2)C1 |
| InChI | InChI=1S/C22H26N2O/c1-14(2)18-10-6-15(3)13-22(18,25)19-11-9-17-8-7-16-5-4-12-23-20(16)21(17)24-19/h4-5,7-9,11-12,14-15,18,25H,6,10,13H2,1-3H3 |
| InChIKey | ZWSDAILIINCYSB-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|