C32H40NO9P — CID 12994406
N-[(2R,3R,4R,5S,6R)-2-(dimethoxyphosphorylmethyl)-2-hydroxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]acetamide (PubChem CID 12994406) has the molecular formula C32H40NO9P and a molecular weight of 613.64 g/mol. Its IUPAC name is N-[(2R,3R,4R,5S,6R)-2-(dimethoxyphosphorylmethyl)-2-hydroxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]acetamide.
| Compound Name | N-[(2R,3R,4R,5S,6R)-2-(dimethoxyphosphorylmethyl)-2-hydroxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 12994406 |
| Molecular Formula | C32H40NO9P |
| Molecular Weight | 613.64 g/mol |
| Exact Mass | 613.24 |
| IUPAC Name | N-[(2R,3R,4R,5S,6R)-2-(dimethoxyphosphorylmethyl)-2-hydroxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]acetamide |
| SMILES | COP(=O)(C[C@]1(O)O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1NC(C)=O)OC |
| InChI | InChI=1S/C32H40NO9P/c1-24(34)33-31-30(41-21-27-17-11-6-12-18-27)29(40-20-26-15-9-5-10-16-26)28(22-39-19-25-13-7-4-8-14-25)42-32(31,35)23-43(36,37-2)38-3/h4-18,28-31,35H,19-23H2,1-3H3,(H,33,34)/t28-,29-,30+,31-,32+/m1/s1 |
| InChIKey | MKJVCJJMZLSNFR-VJLURNNQSA-N |
| XLogP | 4.45 |
| TPSA | 121.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.64 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|