C7H8N2O2S — CID 130006735
5-methyl-4,6-dihydro-[1,3]dioxino[4,5-d]pyrimidine-7-thione (PubChem CID 130006735) has the molecular formula C7H8N2O2S and a molecular weight of 184.22 g/mol. Its IUPAC name is 5-methyl-4,6-dihydro-[1,3]dioxino[4,5-d]pyrimidine-7-thione.
| Compound Name | 5-methyl-4,6-dihydro-[1,3]dioxino[4,5-d]pyrimidine-7-thione |
|---|---|
| PubChem CID | 130006735 |
| Molecular Formula | C7H8N2O2S |
| Molecular Weight | 184.22 g/mol |
| Exact Mass | 184.03 |
| IUPAC Name | 5-methyl-4,6-dihydro-[1,3]dioxino[4,5-d]pyrimidine-7-thione |
| SMILES | Cc1[nH]c(=S)nc2c1COCO2 |
| InChI | InChI=1S/C7H8N2O2S/c1-4-5-2-10-3-11-6(5)9-7(12)8-4/h2-3H2,1H3,(H,8,9,12) |
| InChIKey | ITZQHADQWDHCNR-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.22 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|