C7H7ClN2O3 — CID 130015991
3-(ethylcarbamoyl)-1,2-oxazole-5-carbonyl chloride (PubChem CID 130015991) has the molecular formula C7H7ClN2O3 and a molecular weight of 202.60 g/mol. Its IUPAC name is 3-(ethylcarbamoyl)-1,2-oxazole-5-carbonyl chloride.
| Compound Name | 3-(ethylcarbamoyl)-1,2-oxazole-5-carbonyl chloride |
|---|---|
| PubChem CID | 130015991 |
| Molecular Formula | C7H7ClN2O3 |
| Molecular Weight | 202.60 g/mol |
| Exact Mass | 202.01 |
| IUPAC Name | 3-(ethylcarbamoyl)-1,2-oxazole-5-carbonyl chloride |
| SMILES | CCNC(=O)c1cc(C(=O)Cl)on1 |
| InChI | InChI=1S/C7H7ClN2O3/c1-2-9-7(12)4-3-5(6(8)11)13-10-4/h3H,2H2,1H3,(H,9,12) |
| InChIKey | MQYAANONMMGLFS-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.60 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|