C8H10Cl2N2 — CID 130018341
2,4-dichloro-1-N,1-N-dimethylbenzene-1,3-diamine (PubChem CID 130018341) has the molecular formula C8H10Cl2N2 and a molecular weight of 205.09 g/mol. Its IUPAC name is 2,4-dichloro-1-N,1-N-dimethylbenzene-1,3-diamine.
| Compound Name | 2,4-dichloro-1-N,1-N-dimethylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 130018341 |
| Molecular Formula | C8H10Cl2N2 |
| Molecular Weight | 205.09 g/mol |
| Exact Mass | 204.02 |
| IUPAC Name | 2,4-dichloro-1-N,1-N-dimethylbenzene-1,3-diamine |
| SMILES | CN(C)c1ccc(Cl)c(N)c1Cl |
| InChI | InChI=1S/C8H10Cl2N2/c1-12(2)6-4-3-5(9)8(11)7(6)10/h3-4H,11H2,1-2H3 |
| InChIKey | IFUFOHYERQMJQH-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.09 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|