C7H4O3S — CID 130024628
thiophene-2,3,4-tricarbaldehyde (PubChem CID 130024628) has the molecular formula C7H4O3S and a molecular weight of 168.17 g/mol. Its IUPAC name is thiophene-2,3,4-tricarbaldehyde.
| Compound Name | thiophene-2,3,4-tricarbaldehyde |
|---|---|
| PubChem CID | 130024628 |
| Molecular Formula | C7H4O3S |
| Molecular Weight | 168.17 g/mol |
| Exact Mass | 167.99 |
| IUPAC Name | thiophene-2,3,4-tricarbaldehyde |
| SMILES | O=Cc1csc(C=O)c1C=O |
| InChI | InChI=1S/C7H4O3S/c8-1-5-4-11-7(3-10)6(5)2-9/h1-4H |
| InChIKey | VRPCTUWIDHRSSP-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.17 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|