C10H12O2 — CID 130036267
6-hydroxytricyclo[5.2.1.02,6]dec-8-en-3-one (PubChem CID 130036267) has the molecular formula C10H12O2 and a molecular weight of 164.20 g/mol. Its IUPAC name is 6-hydroxytricyclo[5.2.1.02,6]dec-8-en-3-one.
| Compound Name | 6-hydroxytricyclo[5.2.1.02,6]dec-8-en-3-one |
|---|---|
| PubChem CID | 130036267 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | 6-hydroxytricyclo[5.2.1.02,6]dec-8-en-3-one |
| SMILES | O=C1CCC2(O)C3C=CC(C3)C12 |
| InChI | InChI=1S/C10H12O2/c11-8-3-4-10(12)7-2-1-6(5-7)9(8)10/h1-2,6-7,9,12H,3-5H2 |
| InChIKey | QUWAWCQLOGDZTD-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|